
CAS 1194374-72-5
:Ethyl 3-amino-5-ethyl-1H-pyrrole-2-carboxylate
Description:
Ethyl 3-amino-5-ethyl-1H-pyrrole-2-carboxylate is a chemical compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features an ethyl ester functional group, contributing to its solubility in organic solvents. The presence of an amino group at the 3-position and an ethyl group at the 5-position of the pyrrole ring enhances its reactivity and potential for forming various derivatives. Ethyl 3-amino-5-ethyl-1H-pyrrole-2-carboxylate is likely to exhibit basic properties due to the amino group, making it a candidate for various chemical reactions, including acylation and alkylation. Additionally, the compound may possess biological activity, which could be explored in pharmaceutical applications. Its molecular structure suggests potential interactions with biological systems, making it of interest in medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its reactivity and potential toxicity.
Formula:C9H14N2O2
InChI:InChI=1S/C9H14N2O2/c1-3-6-5-7(10)8(11-6)9(12)13-4-2/h5,11H,3-4,10H2,1-2H3
InChI key:InChIKey=YVRLPBNXXIMQMY-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(N)C=C(CC)N1
Synonyms:- Ethyl 3-amino-5-ethyl-1H-pyrrole-2-carboxylate
- 1H-Pyrrole-2-carboxylic acid, 3-amino-5-ethyl-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
