CAS 1194375-25-1

4,5,6,7-Tetrahydrothieno[3,2-c]pyridine-2-methanol

Description:

4,5,6,7-Tetrahydrothieno[3,2-c]pyridine-2-methanol is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both a thieno and a pyridine ring. This compound features a tetrahydro configuration, indicating that it has four hydrogen atoms added to the rings, resulting in a saturated structure. The presence of a hydroxymethyl group (-CH2OH) at the 2-position of the pyridine ring contributes to its reactivity and potential for forming hydrogen bonds, making it of interest in medicinal chemistry. The compound is likely to exhibit moderate polarity due to the hydroxymethyl group, influencing its solubility in various solvents. Additionally, the bicyclic nature of the molecule may impart specific biological activities, which could be explored in pharmacological studies. Its CAS number, 1194375-25-1, allows for precise identification in chemical databases, facilitating research and application in various fields, including drug development and organic synthesis. Overall, this compound represents a fascinating area of study due to its structural complexity and potential applications.

Formula: C₈H₁₁NOS

InChI: InChI=1S/C8H11NOS/c10-5-7-3-6-4-9-2-1-8(6)11-7/h3,9-10H,1-2,4-5H2

InChI key: InChIKey=VTKFAMFNFIYCPS-UHFFFAOYSA-N

SMILES: C(O)C1=CC2=C(S1)CCNC2

Synonyms:

• Thieno[3,2-c]pyridine-2-methanol, 4,5,6,7-tetrahydro-
• 4,5,6,7-Tetrahydrothieno[3,2-c]pyridine-2-methanol