
CAS 1194375-64-8
:7-Chloro-1,2,3,4-tetrahydro-2-(phenylmethyl)isoquinoline
Description:
7-Chloro-1,2,3,4-tetrahydro-2-(phenylmethyl)isoquinoline is a chemical compound characterized by its isoquinoline structure, which features a bicyclic system containing a benzene ring fused to a pyridine-like ring. The presence of a chlorine atom at the 7-position contributes to its reactivity and potential biological activity. The tetrahydro configuration indicates that the compound has four hydrogenated carbon atoms in its structure, which can influence its physical properties, such as solubility and stability. The phenylmethyl group attached at the 2-position enhances its lipophilicity, potentially affecting its interaction with biological membranes and receptors. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its specific applications and effects would depend on further studies, including its mechanism of action and potential therapeutic uses. As with many organic compounds, safety and handling precautions are essential due to the presence of chlorine and the potential for biological activity.
Formula:C16H16ClN
InChI:InChI=1S/C16H16ClN/c17-16-7-6-14-8-9-18(12-15(14)10-16)11-13-4-2-1-3-5-13/h1-7,10H,8-9,11-12H2
InChI key:InChIKey=WSXLDAUCKLFHHF-UHFFFAOYSA-N
SMILES:C(N1CC=2C(CC1)=CC=C(Cl)C2)C3=CC=CC=C3
Synonyms:- 7-Chloro-1,2,3,4-tetrahydro-2-(phenylmethyl)isoquinoline
- Isoquinoline, 7-chloro-1,2,3,4-tetrahydro-2-(phenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.