
CAS 1194375-88-6
:4-Bromo-1-ethyl-1H-indole
Description:
4-Bromo-1-ethyl-1H-indole is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a bromine atom at the fourth position and an ethyl group at the first position of the indole ring significantly influences its chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent used. It is often utilized in medicinal chemistry and research due to its potential biological activity, including antimicrobial and anticancer properties. The bromine substituent can participate in various chemical reactions, such as nucleophilic substitutions or cross-coupling reactions, making it a valuable intermediate in synthetic organic chemistry. Safety data sheets should be consulted for handling precautions, as halogenated compounds can pose health risks. Overall, 4-Bromo-1-ethyl-1H-indole is a versatile compound with applications in both research and industry.
Formula:C10H10BrN
InChI:InChI=1S/C10H10BrN/c1-2-12-7-6-8-9(11)4-3-5-10(8)12/h3-7H,2H2,1H3
InChI key:InChIKey=ZAYNZVWIRUKCAA-UHFFFAOYSA-N
SMILES:C(C)N1C=2C(=C(Br)C=CC2)C=C1
Synonyms:- 4-Bromo-1-ethyl-1H-indole
- 1H-Indole, 4-bromo-1-ethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.