CymitQuimica logo

CAS 1194376-30-1

:

1,1-Dimethylethyl 3,3-bis(hydroxymethyl)-1-pyrrolidinecarboxylate

Description:
1,1-Dimethylethyl 3,3-bis(hydroxymethyl)-1-pyrrolidinecarboxylate, identified by its CAS number 1194376-30-1, is a chemical compound characterized by its pyrrolidine structure, which features a five-membered ring containing nitrogen. This compound contains two hydroxymethyl groups, contributing to its potential reactivity and solubility in polar solvents. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its steric bulk, which may influence its interactions with other molecules and its overall stability. As a carboxylate ester, it may exhibit properties typical of esters, such as being susceptible to hydrolysis under certain conditions. The compound's unique structure suggests potential applications in organic synthesis, pharmaceuticals, or as a building block in the development of more complex molecules. However, specific data regarding its physical properties, such as boiling point, melting point, and solubility, would require further investigation or experimental determination.
Formula:C11H21NO4
InChI:InChI=1S/C11H21NO4/c1-10(2,3)16-9(15)12-5-4-11(6-12,7-13)8-14/h13-14H,4-8H2,1-3H3
InChI key:InChIKey=QUNLTZBPYGUCRH-UHFFFAOYSA-N
SMILES:C(O)C1(CO)CN(C(OC(C)(C)C)=O)CC1
Synonyms:
  • 1,1-Dimethylethyl 3,3-bis(hydroxymethyl)-1-pyrrolidinecarboxylate
  • 1-Pyrrolidinecarboxylic acid, 3,3-bis(hydroxymethyl)-, 1,1-dimethylethyl ester
  • tert-Butyl 3,3-bis(hydroxymethyl)pyrrolidine-1-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.