CAS 1194376-44-7
:tert-butyl-6-oxo-2,7-diazaspiro[4.4]nonane-2-carboxylate
Description:
Tert-butyl-6-oxo-2,7-diazaspiro[4.4]nonane-2-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which incorporates both nitrogen and carbon atoms. The presence of the tert-butyl group contributes to its hydrophobic properties, while the carboxylate functional group enhances its reactivity and solubility in polar solvents. The compound features a six-membered carbonyl group, which is indicative of its ketone functionality, and the diazaspiro framework suggests potential applications in medicinal chemistry due to its structural complexity. This compound may exhibit interesting biological activities, making it a candidate for further research in drug development. Its molecular structure allows for various synthetic modifications, which can lead to derivatives with enhanced properties. Overall, tert-butyl-6-oxo-2,7-diazaspiro[4.4]nonane-2-carboxylate represents a fascinating subject for study in organic and medicinal chemistry, with potential implications in the design of novel therapeutic agents.
Formula:C12H20N2O3
InChI:InChI=1S/C12H20N2O3/c1-11(2,3)17-10(16)14-7-5-12(8-14)4-6-13-9(12)15/h4-8H2,1-3H3,(H,13,15)
InChI key:RJXAFHSMTSRJKE-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC2(C1)CCNC2=O
Synonyms:- tert-Butyl 6-oxo-2,7-diazaspiro[4.4]nonane-2-carboxylate
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
tert-Butyl 6-oxo-2,7-diazaspiro[4.4]nonane-2-carboxylate
CAS:tert-Butyl 6-oxo-2,7-diazaspiro[4.4]nonane-2-carboxylateFormula:C12H20N2O3Purity:97%Molecular weight:240.3tert-butyl 6-oxo-2,7-diazaspiro[4.4]nonane-2-carboxylate
CAS:Formula:C12H20N2O3Purity:97%Color and Shape:SolidMolecular weight:240.2988tert-Butyl 6-oxo-2,7-diazaspiro[4.4]nonane-2-carboxylate
CAS:tert-Butyl 6-oxo-2,7-diazaspiro[4.4]nonane-2-carboxylateFormula:C12H20N2O3Purity:97%Molecular weight:240.3tert-Butyl 6-oxo-2,7-diazaspiro[4.4]nonane-2-carboxylate
CAS:Formula:C12H20N2O3Purity:97%Color and Shape:SolidMolecular weight:240.3032-Boc-2,7-diazaspiro[4.4]nonane-6-one
CAS:2-Boc-2,7-diazaspiro[4.4]nonane-6-one is a tertiary amine that has three hydrogen bonds to the carbonyl group and one to the nitrogen atom in the 2 position of the pyran ring. The compound exists as two conformations: one with a chair conformation and another with a boat conformation. In each case, the tertiary amine hydrogen bonds to the carbonyl carbon atom. The chair conformation is favored because it has less steric strain on the tertiary amine nitrogen atom than does the boat conformation.Formula:C12H20N2O3Purity:Min. 95%Molecular weight:240.3 g/mol




