CAS 119445-91-9

Dichlorobis[(1,2,3,4,5-η)-1,2-dimethyl-2,4-cyclopentadien-1-yl]zirconium

Description:

Dichlorobis[(1,2,3,4,5-η)-1,2-dimethyl-2,4-cyclopentadien-1-yl]zirconium, with CAS number 119445-91-9, is a coordination compound featuring zirconium as the central metal atom. This compound is characterized by its unique structure, which includes two chlorides and two cyclopentadienyl ligands that are symmetrically bound to the zirconium center. The cyclopentadienyl ligands are derived from a dimethyl-substituted cyclopentadiene, contributing to the compound's stability and reactivity. Typically, such compounds exhibit interesting catalytic properties, particularly in polymerization reactions, due to the presence of the transition metal and the ability of the ligands to stabilize various oxidation states. The compound is generally handled under inert atmospheres to prevent degradation or reaction with moisture. Its applications are primarily found in the field of organometallic chemistry and materials science, where it may serve as a precursor for zirconium-based catalysts or materials. Safety precautions should be taken when handling this compound, as it may pose health risks associated with its chemical reactivity and potential toxicity.

Formula: C₁₄H₁₈Cl₂Zr

InChI: InChI=1S/2C7H9.2ClH.Zr/c2*1-6-4-3-5-7(6)2;;;/h2*3-5H,1-2H3;2*1H;/q2*-1;;;+4/p-2

InChI key: InChIKey=LYIFUDYXUORMPY-UHFFFAOYSA-L

SMILES: [Cl-][Zr+4]12345678([Cl-])([C-]9(C)C1(C)=[CH]2[CH]3=[CH]49)[C-]%10(C)C5(C)=[CH]6[CH]7=[CH]8%10

Synonyms:

• Zirconium, dichlorobis[(1,2,3,4,5-η)-1,2-dimethyl-2,4-cyclopentadien-1-yl]-
• Dichlorobis[(1,2,3,4,5-η)-1,2-dimethyl-2,4-cyclopentadien-1-yl]zirconium
• Bis(1,2-dimethylcyclopentadienyl)zirconium dichloride
• Dichlorobis(η5-1,2-dimethylcyclopentadienyl)zirconium
• 1,3-Cyclopentadiene, 1,2-dimethyl-, zirconium complex

Zirconium, dichlorobis[(1,2,3,4,5-η)-1,2-dimethyl-2,4-cyclopentadien-1-yl]-

CAS: 119445-91-9

Formula: C₁₄H₁₈Cl₂Zr

Molecular weight: 348.4227

Ref: IN-DA000ISA