CAS 119448-82-7
:ethyl 2-phenylimidazo[1,2-a]pyridine-3-carboxylate
Description:
Ethyl 2-phenylimidazo[1,2-a]pyridine-3-carboxylate is a chemical compound characterized by its complex heterocyclic structure, which includes an imidazo and pyridine ring system. This compound typically appears as a solid or crystalline substance and is known for its potential biological activity, particularly in medicinal chemistry. The presence of the ethyl ester functional group contributes to its solubility properties, making it more amenable for various chemical reactions and applications. Its molecular structure suggests that it may exhibit interesting pharmacological properties, potentially acting as a scaffold for drug development. The compound's CAS number, 119448-82-7, allows for its identification in chemical databases and literature. As with many heterocyclic compounds, it may participate in diverse chemical reactions, including nucleophilic substitutions and cycloadditions, which can be exploited in synthetic organic chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C16H14N2O2
InChI:InChI=1/C16H14N2O2/c1-2-20-16(19)15-14(12-8-4-3-5-9-12)17-13-10-6-7-11-18(13)15/h3-11H,2H2,1H3
SMILES:CCOC(=O)c1c(c2ccccc2)nc2ccccn12
Synonyms:- Imidazo[1,2-a]pyridine-3-carboxylic acid, 2-phenyl-, ethyl ester
- Ethyl 2-phenylimidazo[1,2-a]pyridine-3-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Ethyl 2-phenylimidazo[1,2-a]pyridine-3-carboxylate
CAS:Ethyl 2-phenylimidazo[1,2-a]pyridine-3-carboxylateColor and Shape:SolidMolecular weight:266.29g/molEthyl 2-Phenylimidazo[1,2-a]pyridine-3-carboxylate
CAS:Color and Shape:SolidMolecular weight:266.29998779296875


