
CAS 1194508-26-3
:β-Methyl-2-oxazoleethanamine
Description:
β-Methyl-2-oxazoleethanamine, identified by its CAS number 1194508-26-3, is a chemical compound that features a unique structure combining an oxazole ring with an ethylamine side chain. This compound is characterized by its heterocyclic structure, which includes both nitrogen and oxygen atoms in the ring, contributing to its potential reactivity and biological activity. The presence of the methyl group at the beta position of the oxazole ring can influence its solubility and interaction with biological systems. β-Methyl-2-oxazoleethanamine may exhibit properties such as being a potential ligand for various receptors or enzymes, making it of interest in medicinal chemistry and drug development. Its synthesis typically involves multi-step organic reactions, and it may be evaluated for its pharmacological properties in various biological assays. As with many nitrogen-containing heterocycles, it may also display interesting electronic properties, which can be harnessed in material science applications. However, specific applications and safety profiles would require further investigation and data.
Formula:C6H10N2O
InChI:InChI=1S/C6H10N2O/c1-5(4-7)6-8-2-3-9-6/h2-3,5H,4,7H2,1H3
InChI key:InChIKey=TVGPJYMDVWMKJO-UHFFFAOYSA-N
SMILES:C(CN)(C)C1=NC=CO1
Synonyms:- 2-(1,3-Oxazol-2-yl)propan-1-amine
- β-Methyl-2-oxazoleethanamine
- 2-(Oxazol-2-yl)propan-1-amine
- 2-Oxazoleethanamine, β-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
