CymitQuimica logo

CAS 1194508-29-6

:

3-(Chloromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine

Description:
3-(Chloromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine is a heterocyclic organic compound characterized by its unique pyrazolo-pyridine structure. This compound features a tetrahydropyridine ring fused with a pyrazole moiety, which contributes to its potential biological activity. The presence of a chloromethyl group enhances its reactivity, making it a useful intermediate in organic synthesis and medicinal chemistry. Typically, compounds of this nature exhibit a range of pharmacological properties, including potential neuroactive effects, due to their ability to interact with various biological targets. The molecular structure allows for various substitution patterns, which can influence its solubility, stability, and overall reactivity. Additionally, the compound's properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. As with many heterocycles, it may also exhibit interesting electronic properties, making it a subject of interest in materials science and drug development. Safety and handling precautions should be observed due to the presence of the chloromethyl group, which can be reactive.
Formula:C8H11ClN2
InChI:InChI=1S/C8H11ClN2/c9-5-7-6-10-11-4-2-1-3-8(7)11/h6H,1-5H2
InChI key:InChIKey=CTIHHJGRIJIQQL-UHFFFAOYSA-N
SMILES:C(Cl)C1=C2N(N=C1)CCCC2
Synonyms:
  • 3-(Chloromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine
  • Pyrazolo[1,5-a]pyridine, 3-(chloromethyl)-4,5,6,7-tetrahydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.