CAS 1194550-61-2: 1,1-Dimethylethyl 5,7-dichloro-3,4-dihydro-6-[[[(1S)-1-[[3-(methylsulfonyl)phenyl]methyl]-2-oxo-2-(phenylmethoxy)ethyl]amino]carbonyl]-2(1H)-isoquinolinecarboxylate
Description:1,1-Dimethylethyl 5,7-dichloro-3,4-dihydro-6-[[[(1S)-1-[[3-(methylsulfonyl)phenyl]methyl]-2-oxo-2-(phenylmethoxy)ethyl]amino]carbonyl]-2(1H)-isoquinolinecarboxylate, with CAS number 1194550-61-2, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as chloro, sulfonyl, and amine moieties. This compound is likely to exhibit significant biological activity due to its isoquinoline core, which is often associated with various pharmacological properties. The presence of the dimethyl group suggests potential steric hindrance, which may influence its reactivity and interaction with biological targets. Additionally, the sulfonyl group may enhance solubility and bioavailability. The compound's synthesis and characterization would typically involve advanced organic chemistry techniques, including NMR spectroscopy and mass spectrometry, to confirm its structure and purity. Overall, this substance may have applications in medicinal chemistry, particularly in the development of new therapeutic agents.
Formula:C32H34Cl2N2O7S
InChI:InChI=1S/C32H34Cl2N2O7S/c1-32(2,3)43-31(39)36-14-13-24-22(18-36)17-25(33)27(28(24)34)29(37)35-26(30(38)42-19-20-9-6-5-7-10-20)16-21-11-8-12-23(15-21)44(4,40)41/h5-12,15,17,26H,13-14,16,18-19H2,1-4H3,(H,35,37)/t26-/m0/s1
InChI key:InChIKey=ZTYYSZJSTXFVKI-SANMLTNESA-N
SMILES:O=C(OC(C)(C)C)N1CC2=CC(Cl)=C(C(=O)NC(C(=O)OCC=3C=CC=CC3)CC4=CC=CC(=C4)S(=O)(=O)C)C(Cl)=C2CC1
- Synonyms:
- 1,1-Dimethylethyl 5,7-dichloro-3,4-dihydro-6-[[[(1S)-1-[[3-(methylsulfonyl)phenyl]methyl]-2-oxo-2-(phenylmethoxy)ethyl]amino]carbonyl]-2(1H)-isoquinolinecarboxylate
- Benzyl (S)-2-[[[2-(tert-butoxycarbonyl)-5,7-dichloro-1,2,3,4-tetrahydroisoquinolin-6-yl]carbonyl]amino]-3-[3-(methylsulfonyl)phenyl]propanoate
- 2(1H)-Isoquinolinecarboxylic acid, 5,7-dichloro-3,4-dihydro-6-[[[(1S)-1-[[3-(methylsulfonyl)phenyl]methyl]-2-oxo-2-(phenylmethoxy)ethyl]amino]carbonyl]-, 1,1-dimethylethyl ester
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Lifitegrast Impurity 1 REF: 4Z-L-153003CAS: 1194550-61-2 | - - - | To inquire | Mon 21 Apr 25 |

Ref: 4Z-L-153003
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |