CymitQuimica logo

CAS 119457-18-0

:

(4Z)-2-[(2-chloro-6H-indolo[2,3-b]quinoxalin-6-yl)acetyl]-5-methyl-4-(1-phenylethylidene)-2,4-dihydro-3H-pyrazol-3-one

Description:
The chemical substance with the name "(4Z)-2-[(2-chloro-6H-indolo[2,3-b]quinoxalin-6-yl)acetyl]-5-methyl-4-(1-phenylethylidene)-2,4-dihydro-3H-pyrazol-3-one" and CAS number "119457-18-0" is a complex organic compound characterized by its unique structural features, including a pyrazolone core, an indoloquinoxaline moiety, and a phenylethylidene substituent. This compound exhibits potential biological activity, which may include anti-inflammatory or anticancer properties, attributed to the presence of the indole and quinoxaline rings that are known for their pharmacological significance. The chloro substituent may enhance its reactivity and influence its interaction with biological targets. Additionally, the compound's structural configuration suggests it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Its solubility, stability, and reactivity can be influenced by the functional groups present, making it a candidate for further research in medicinal chemistry and drug development. Overall, this compound represents a fascinating example of synthetic organic chemistry with potential applications in therapeutic contexts.
Formula:C28H20ClN5O2
InChI:InChI=1/C28H20ClN5O2/c1-16(18-8-4-3-5-9-18)25-17(2)32-34(28(25)36)24(35)15-33-23-11-7-6-10-20(23)26-27(33)31-21-13-12-19(29)14-22(21)30-26/h3-14H,15H2,1-2H3/b25-16-
Synonyms:
  • 3H-Pyrazol-3-one, 2,4-dihydro-2-((2-chloro-6H-indolo(2,3-b)quinoxalin-6-yl)acetyl)-5-methyl-4-(1-phenylethylidene)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.