CymitQuimica logo

CAS 119461-40-4

:

(S)-1-Tosyl-2-methylaziridine

Description:
(S)-1-Tosyl-2-methylaziridine is a chiral aziridine derivative characterized by its three-membered ring structure, which includes a nitrogen atom and two carbon atoms. The presence of the tosyl group (p-toluenesulfonyl) enhances its reactivity, making it a useful intermediate in organic synthesis, particularly in the formation of more complex molecules. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its chirality is significant in pharmaceutical applications, as it can influence the biological activity of the resulting compounds. The aziridine ring is strained, which contributes to its reactivity, allowing for various nucleophilic substitutions and ring-opening reactions. Additionally, (S)-1-Tosyl-2-methylaziridine can participate in asymmetric synthesis, making it valuable in the development of enantiomerically pure compounds. Safety data indicates that, like many aziridines, it should be handled with care due to potential toxicity and reactivity. Overall, this compound is an important building block in synthetic organic chemistry.
Formula:C10H13NO2S
InChI:InChI=1/C10H13NO2S/c1-8-3-5-10(6-4-8)14(12,13)11-7-9(11)2/h3-6,9H,7H2,1-2H3/t9-,11?/m0/s1
SMILES:Cc1ccc(cc1)S(=O)(=O)N1C[C@@H]1C
Synonyms:
  • (S)-2-Methyl-1-[(4-methylphenyl)sulfonyl]aziridine
  • (2S)-2-methyl-1-[(4-methylphenyl)sulfonyl]aziridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.