CymitQuimica logo

CAS 1194761-35-7

:

[N(E)]-N-[(4-Chlorophenyl)methylene]phenylalanine methyl ester

Description:
[N(E)]-N-[(4-Chlorophenyl)methylene]phenylalanine methyl ester is a chemical compound characterized by its structure, which includes a phenylalanine derivative with a methylene bridge connecting a 4-chlorophenyl group. This compound features an ester functional group, which is indicative of its potential reactivity and solubility properties. The presence of the chlorine atom on the aromatic ring can influence its electronic properties, potentially enhancing its biological activity or interaction with other molecules. The methyl ester group suggests that the compound may exhibit lipophilic characteristics, which can affect its absorption and distribution in biological systems. Additionally, the compound's structure may allow for various applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Overall, the unique combination of functional groups and structural features contributes to its potential utility in research and therapeutic contexts.
Formula:C17H16ClNO2
InChI:InChI=1/C17H16ClNO2/c1-21-17(20)16(11-13-5-3-2-4-6-13)19-12-14-7-9-15(18)10-8-14/h2-10,12,16H,11H2,1H3/b19-12+
InChI key:InChIKey=KCAWLBQPKIIOAP-XDHOZWIPNA-N
SMILES:C(CC1=CC=CC=C1)(C(OC)=O)/N=C/C2=CC=C(Cl)C=C2
Synonyms:
  • Phenylalanine, N-[(4-chlorophenyl)methylene]-, methyl ester, [N(E)]-
  • [N(E)]-N-[(4-Chlorophenyl)methylene]phenylalanine methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.