CymitQuimica logo

CAS 119483-46-4

:

L-Alloisoleucine, 1,1-dimethylethyl ester, hydrochloride

Description:
L-Alloisoleucine, 1,1-dimethylethyl ester, hydrochloride is a chemical compound that belongs to the class of amino acids and their derivatives. It is a hydrochloride salt, which indicates that it is a protonated form of the base compound, enhancing its solubility in water. This compound is characterized by its chiral nature, possessing specific stereochemistry that is crucial for its biological activity. The presence of the 1,1-dimethylethyl ester group suggests that it has been modified to improve its stability or bioavailability. As an amino acid derivative, it may play a role in various biochemical processes, including protein synthesis and metabolism. The hydrochloride form typically enhances the compound's stability and solubility, making it suitable for pharmaceutical applications. Its CAS number, 119483-46-4, is a unique identifier that facilitates the identification and study of this specific compound in scientific literature and databases. Overall, L-Alloisoleucine, 1,1-dimethylethyl ester, hydrochloride is of interest in both research and potential therapeutic contexts.
Formula:C10H21NO2·ClH
InChI:InChI=1S/C10H21NO2.ClH/c1-6-7(2)8(11)9(12)13-10(3,4)5;/h7-8H,6,11H2,1-5H3;1H/t7-,8+;/m1./s1
InChI key:InChIKey=IFRYMHOZFAPYPJ-WLYNEOFISA-N
SMILES:C([C@H]([C@@H](CC)C)N)(OC(C)(C)C)=O.Cl
Synonyms:
  • L-Alloisoleucine, 1,1-dimethylethyl ester, hydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.