CymitQuimica logo

CAS 119483-48-6

:

L-Norleucine, 1,1-dimethylethyl ester, hydrochloride

Description:
L-Norleucine, 1,1-dimethylethyl ester, hydrochloride is a synthetic derivative of the amino acid norleucine, characterized by the presence of a tert-butyl ester group and a hydrochloride salt form. This compound typically appears as a white to off-white crystalline powder, which is soluble in water and polar organic solvents. Its molecular structure includes a side chain that contributes to its hydrophobic properties, making it relevant in various biochemical applications. The hydrochloride form enhances its stability and solubility, facilitating its use in research and potential pharmaceutical applications. L-Norleucine is often studied for its role in protein synthesis and as a building block in peptide synthesis. Additionally, it may exhibit biological activity, influencing metabolic pathways or serving as a substrate for enzymatic reactions. As with many amino acid derivatives, it is essential to handle this compound with care, following appropriate safety protocols due to potential reactivity and biological effects.
Formula:C10H21NO2·ClH
InChI:InChI=1S/C10H21NO2.ClH/c1-5-6-7-8(11)9(12)13-10(2,3)4;/h8H,5-7,11H2,1-4H3;1H/t8-;/m0./s1
InChI key:InChIKey=YWUGPFDZLBSQBJ-QRPNPIFTSA-N
SMILES:C([C@H](CCCC)N)(OC(C)(C)C)=O.Cl
Synonyms:
  • Norleucine tert-butyl ester hydrochloride
  • L-Norleucine, 1,1-dimethylethyl ester, hydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.