CAS 119485-59-5
:2-(Tributylstannyl)-3-thiophenecarboxaldehyde
Description:
2-(Tributylstannyl)-3-thiophenecarboxaldehyde is an organotin compound characterized by the presence of a thiophene ring and a carboxaldehyde functional group, along with a tributylstannyl substituent. The tributylstannyl group contributes to its unique reactivity and solubility properties, making it useful in various synthetic applications, particularly in organometallic chemistry. The thiophene moiety imparts aromatic characteristics, enhancing the compound's stability and potential for electronic applications. This compound is typically a colorless to pale yellow liquid, exhibiting moderate volatility. Its reactivity is influenced by the aldehyde group, which can participate in nucleophilic addition reactions, while the organotin component can facilitate coupling reactions. Due to the presence of tin, it is essential to handle this compound with care, as organotin compounds can be toxic and environmentally hazardous. Overall, 2-(Tributylstannyl)-3-thiophenecarboxaldehyde serves as a valuable intermediate in the synthesis of more complex organic molecules and materials.
Formula:C17H30OSSn
InChI:InChI=1S/C5H3OS.3C4H9.Sn/c6-3-5-1-2-7-4-5;3*1-3-4-2;/h1-3H;3*1,3-4H2,2H3;
InChI key:InChIKey=SSMHFKUIMCGNAC-UHFFFAOYSA-N
SMILES:[Sn](CCCC)(CCCC)(CCCC)C1=C(C=O)C=CS1
Synonyms:- 2-(Tributylstannyl)-3-thiophenecarboxaldehyde
- 3-Thiophenecarboxaldehyde, 2-(tributylstannyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
