CAS 119486-07-6
:N,α-Diethylbenzeneethanamine
Description:
N,α-Diethylbenzeneethanamine, identified by its CAS number 119486-07-6, is an organic compound characterized by its amine functional group and a structure that includes both ethyl and benzene moieties. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the benzene ring contributes to its hydrophobic characteristics, while the ethyl groups enhance its steric bulk. As a secondary amine, it may participate in various chemical reactions, including alkylation and acylation. The compound's potential applications could span across fields such as pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. However, specific safety and handling guidelines should be adhered to, as with any chemical substance, due to potential toxicity or reactivity. Overall, N,α-Diethylbenzeneethanamine represents a unique structure within the class of amines, with properties that can be tailored for specific applications in chemical synthesis or industry.
Formula:C12H19N
InChI:InChI=1S/C12H19N/c1-3-12(13-4-2)10-11-8-6-5-7-9-11/h5-9,12-13H,3-4,10H2,1-2H3
InChI key:InChIKey=KHWYSUBVXWWBRB-UHFFFAOYSA-N
SMILES:C(C(NCC)CC)C1=CC=CC=C1
Synonyms:- Benzeneethanamine, N,α-diethyl-
- N,α-Diethylbenzeneethanamine
- ethyl(1-phenylbutan-2-yl)amine
- N,alpha-Diethylphenylethylamine, EAPB
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Ethyl(1-phenylbutan-2-yl)amine
CAS:Controlled ProductEthyl(1-phenylbutan-2-yl)amine is a fatty acid that has been shown to be effective in the treatment of HIV infection. It binds to the enzyme ns3 protease, which prevents the virus from replicating. The drug has also been shown to bind to monoclonal antibodies and show high values, making it resistant to resistant mutants. Ethyl(1-phenylbutan-2-yl)amine is soluble in organic solvents and can be crystallized as either an amorphous or a crystalline polymorph. It is an inhibitor of the cationic polymerization of hydrochloric acid and an activator of locomotor activity. This drug also acts as a receptor for urine samples.
Formula:C12H19NPurity:Min. 95%Molecular weight:177.29 g/mol
