CymitQuimica logo

CAS 119492-01-2

:

4-TERT-BUTYL-2-[3-(TRIFLUOROMETHYL)PHENYL]-MORPHOLINE

Description:
4-Tert-butyl-2-[3-(trifluoromethyl)phenyl]-morpholine is an organic compound characterized by its morpholine structure, which includes a tert-butyl group and a trifluoromethyl-substituted phenyl group. The presence of the tert-butyl group contributes to its hydrophobic nature, while the trifluoromethyl group enhances its electron-withdrawing properties, affecting its reactivity and solubility in various solvents. This compound is typically a colorless to light yellow liquid or solid, depending on the temperature and purity. It exhibits moderate stability under standard conditions but may undergo reactions typical of morpholines, such as nucleophilic substitutions or ring-opening reactions under certain conditions. Its unique structure makes it of interest in various fields, including pharmaceuticals and agrochemicals, where it may serve as an intermediate or a building block for more complex molecules. Safety data should be consulted for handling, as compounds with trifluoromethyl groups can exhibit specific toxicological profiles.
Formula:C15H20F3NO
InChI:InChI=1/C15H20F3NO/c1-14(2,3)19-7-8-20-13(10-19)11-5-4-6-12(9-11)15(16,17)18/h4-6,9,13H,7-8,10H2,1-3H3
SMILES:CC(C)(C)N1CCOC(C1)c1cccc(c1)C(F)(F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.