
CAS 119492-75-0
:1-(4-Chlorophenyl)-4-phenyl-3-butyn-1-one
Description:
1-(4-Chlorophenyl)-4-phenyl-3-butyn-1-one, with the CAS number 119492-75-0, is an organic compound characterized by its distinct structural features. It belongs to the class of alkynones, which are compounds containing both a carbon-carbon triple bond and a ketone functional group. This particular compound exhibits a phenyl group and a para-chlorophenyl substituent, contributing to its aromatic character and potentially influencing its reactivity and solubility. The presence of the butynone moiety suggests that it may participate in various chemical reactions, including nucleophilic additions and cycloadditions. Its chlorinated aromatic ring can enhance its biological activity and lipophilicity, making it of interest in medicinal chemistry and material science. The compound's physical properties, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the presence of functional groups. Overall, 1-(4-Chlorophenyl)-4-phenyl-3-butyn-1-one is a versatile compound with potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C16H11ClO
InChI:InChI=1S/C16H11ClO/c17-15-11-9-14(10-12-15)16(18)8-4-7-13-5-2-1-3-6-13/h1-3,5-6,9-12H,8H2
InChI key:InChIKey=DHGNOMPPFYQVSX-UHFFFAOYSA-N
SMILES:C(CC#CC1=CC=CC=C1)(=O)C2=CC=C(Cl)C=C2
Synonyms:- 1-(4-Chlorophenyl)-4-phenyl-3-butyn-1-one
- 3-Butyn-1-one, 1-(4-chlorophenyl)-4-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
