
CAS 119499-71-7
:2,6-Piperidinedione, 1-methyl-, homopolymer
Description:
2,6-Piperidinedione, 1-methyl-, homopolymer, identified by CAS number 119499-71-7, is a synthetic polymer derived from the polymerization of a specific piperidine derivative. This compound typically exhibits characteristics common to polyamides, including good thermal stability, mechanical strength, and resistance to various solvents. The presence of piperidine rings in its structure contributes to its potential applications in coatings, adhesives, and as a modifier in plastics. The polymer's properties can be influenced by factors such as molecular weight and the degree of crystallinity, which affect its solubility and processing behavior. Additionally, the functional groups present in the polymer may impart specific reactivity, allowing for further chemical modifications. Overall, 2,6-Piperidinedione, 1-methyl-, homopolymer is notable for its versatility in industrial applications, particularly in fields requiring durable and resilient materials.
Formula:(C6H9NO2)x
InChI:InChI=1S/C6H9NO2/c1-7-5(8)3-2-4-6(7)9/h2-4H2,1H3
InChI key:InChIKey=VUYOLIKWIVQHBC-UHFFFAOYSA-N
SMILES:CN1C(=O)CCCC1=O
Synonyms:- 2,6-Piperidinedione, 1-methyl-, homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
