
CAS 1195-06-8
:2,4-Diaminoethylbenzene
Description:
2,4-Diaminoethylbenzene, also known as 2,4-diaminotoluene, is an aromatic amine characterized by the presence of two amino groups (-NH2) and an ethyl side chain attached to a benzene ring. This compound typically appears as a solid at room temperature and is soluble in organic solvents. Its molecular structure contributes to its reactivity, particularly in electrophilic substitution reactions, making it useful in the synthesis of dyes, pharmaceuticals, and other organic compounds. The amino groups can participate in hydrogen bonding, influencing its physical properties such as melting and boiling points. Additionally, 2,4-diaminoethylbenzene is known to be a potential health hazard, as many aromatic amines are associated with carcinogenicity and toxicity. Therefore, handling this substance requires appropriate safety measures to minimize exposure. Its applications in various chemical processes highlight its significance in industrial chemistry, particularly in the production of colorants and intermediates for further chemical synthesis.
Formula:C8H12N2
InChI:InChI=1S/C8H12N2/c1-2-6-3-4-7(9)5-8(6)10/h3-5H,2,9-10H2,1H3
InChI key:InChIKey=PTMVFRKAMOUORT-UHFFFAOYSA-N
SMILES:C(C)C1=C(N)C=C(N)C=C1
Synonyms:- 4-Ethyl-1,3-benzenediamine
- m-Phenylenediamine, 4-ethyl-
- 2,4-Diaminoethylbenzene
- 1,3-Benzenediamine, 4-ethyl-
- 4-Ethyl-1,3-phenylenediamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
