CymitQuimica logo

CAS 1195-20-6

:

(4S,5R)-5-Methyl-2-oxooxazolidine-4-carboxylic acid

Description:
(4S,5R)-5-Methyl-2-oxooxazolidine-4-carboxylic acid, with the CAS number 1195-20-6, is a chiral compound characterized by its oxazolidine ring structure, which incorporates both a carboxylic acid and a ketone functional group. This compound is notable for its stereochemistry, specifically the (4S,5R) configuration, which contributes to its biological activity and potential applications in pharmaceuticals, particularly in the synthesis of amino acids and peptides. The presence of the methyl group at the 5-position and the carboxylic acid at the 4-position enhances its reactivity and solubility in polar solvents. As a result, it may participate in various chemical reactions, including condensation and cyclization processes. Its unique structure allows it to serve as a building block in organic synthesis, especially in the development of biologically active molecules. Additionally, the compound's chirality is significant in the context of drug design, where the specific stereoisomer can influence the efficacy and safety of therapeutic agents.
Formula:C5H7NO4
InChI:InChI=1S/C5H7NO4/c1-2-3(4(7)8)6-5(9)10-2/h2-3H,1H3,(H,6,9)(H,7,8)/t2-,3+/m1/s1
InChI key:InChIKey=KYNKAUUXUQOZSQ-GBXIJSLDSA-N
SMILES:C(O)(=O)[C@H]1NC(=O)O[C@@H]1C
Synonyms:
  • (4S,5R)-5-Methyl-2-oxo-4-oxazolidinecarboxylic acid
  • 4-Oxazolidinecarboxylic acid, 5-methyl-2-oxo-, (4S,5R)-
  • 4-Oxazolidinecarboxylic acid, 5-methyl-2-oxo-, (4S-trans)-
  • (4S,5R)-5-Methyl-2-oxooxazolidine-4-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.