CAS 1195-25-1
:3-methyl-5-(trichloromethyl)-1,2,4-oxadiazole
Description:
3-Methyl-5-(trichloromethyl)-1,2,4-oxadiazole is a heterocyclic compound characterized by its oxadiazole ring, which consists of two nitrogen atoms and three carbon atoms in a five-membered ring. The presence of a methyl group at the 3-position and a trichloromethyl group at the 5-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and form. It is known for its potential applications in agrochemicals and pharmaceuticals, particularly as a building block in the synthesis of various biologically active compounds. The trichloromethyl group enhances its reactivity, making it a useful intermediate in organic synthesis. However, due to the presence of chlorine atoms, it may also pose environmental and health risks, necessitating careful handling and disposal. Overall, 3-methyl-5-(trichloromethyl)-1,2,4-oxadiazole is a significant compound in the field of synthetic chemistry, with diverse applications and implications.
Formula:C4H3Cl3N2O
InChI:InChI=1/C4H3Cl3N2O/c1-2-8-3(10-9-2)4(5,6)7/h1H3
SMILES:Cc1nc(C(Cl)(Cl)Cl)on1
Synonyms:- 1,2,4-Oxadiazole, 3-Methyl-5-(Trichloromethyl)-
- 3-Methyl-5-(trichloromethyl)-1,2,4-oxadiazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,2,4-Oxadiazole, 3-methyl-5-(trichloromethyl)-
CAS:Formula:C4H3Cl3N2OPurity:97%Color and Shape:LiquidMolecular weight:201.43843-Methyl-5-trichloromethyl-[1,2,4]oxadiazole
CAS:3-Methyl-5-trichloromethyl-[1,2,4]oxadiazolePurity:95%Molecular weight:201.44g/mol3-Methyl-5-(trichloromethyl)-1,2,4-oxadiazole
CAS:<p>3-Methyl-5-(trichloromethyl)-1,2,4-oxadiazole is an acylation agent that belongs to the group of c3-10 cycloalkyl derivs. It is a colorless, crystalline compound with a strong odor and a melting point of 171°C. 3-Methyl-5-(trichloromethyl)-1,2,4-oxadiazole can be used as an acylating agent for polymers. This chemical has been shown to cause erethism in humans and animals.</p>Formula:C4H3Cl3N2OPurity:Min. 95%Molecular weight:201.44 g/mol



