CAS 1195-81-9: Cyclobutanecarboxylic acid, 1-(hydroxymethyl)-, ethyl ester
Description:Cyclobutanecarboxylic acid, 1-(hydroxymethyl)-, ethyl ester, with the CAS number 1195-81-9, is an organic compound characterized by its cyclobutane ring structure, which contributes to its unique chemical properties. This compound features a carboxylic acid functional group and an ethyl ester moiety, indicating it can participate in various chemical reactions typical of esters and carboxylic acids. The presence of a hydroxymethyl group adds to its reactivity and potential for hydrogen bonding, influencing its solubility and boiling point. Generally, compounds of this nature are of interest in organic synthesis and may exhibit biological activity, making them relevant in medicinal chemistry. The cyclobutane ring can impart strain, which may affect the stability and reactivity of the molecule. Additionally, the ester functionality suggests that it can undergo hydrolysis, transesterification, and other reactions common to esters. Overall, cyclobutanecarboxylic acid, 1-(hydroxymethyl)-, ethyl ester is a versatile compound with potential applications in various chemical fields.
Formula:C8H14O3
InChI:InChI=1S/C8H14O3/c1-2-11-7(10)8(6-9)4-3-5-8/h9H,2-6H2,1H3
InChI key:InChIKey=PWMQFMMZBJUHID-UHFFFAOYSA-N
SMILES:O=C(OCC)C1(CO)CCC1
- Synonyms:
- Ethyl 1-(hydroxymethyl)cyclobutanecarboxylate
- Cyclobutanecarboxylic acid, 1-(hydroxymethyl)-, ethyl ester
Ethyl 1-(hydroxymethyl)cyclobutanecarboxylate, 97%
Ref: 02-H62566
| 1g | To inquire | ||
| 5g | To inquire | ||
| 250mg | To inquire |
Cyclobutanecarboxylic acid, 1-(hydroxymethyl)-, ethyl ester
Ref: IN-DA000IWB
| 1g | 142.00 € | ||
| 100mg | 50.00 € | ||
| 250mg | 63.00 € |
Ethyl 1-(hydroxymethyl)cyclobutane-1-carboxylate
Ref: 10-F603074
| 1g | To inquire | ||
| 100mg | To inquire | ||
| 250mg | To inquire |
Ethyl 1-hydroxymethylcyclobutanecarboxylate
Ref: 3D-BAA19581
| 2500mg | 628.00 € |
