CAS 1195-81-9
:Cyclobutanecarboxylic acid, 1-(hydroxymethyl)-, ethyl ester
Description:
Cyclobutanecarboxylic acid, 1-(hydroxymethyl)-, ethyl ester, with the CAS number 1195-81-9, is an organic compound characterized by its cyclobutane ring structure, which contributes to its unique chemical properties. This compound features a carboxylic acid functional group and an ethyl ester moiety, indicating it can participate in various chemical reactions typical of esters and carboxylic acids. The presence of a hydroxymethyl group adds to its reactivity and potential for hydrogen bonding, influencing its solubility and boiling point. Generally, compounds of this nature are of interest in organic synthesis and may exhibit biological activity, making them relevant in medicinal chemistry. The cyclobutane ring can impart strain, which may affect the stability and reactivity of the molecule. Additionally, the ester functionality suggests that it can undergo hydrolysis, transesterification, and other reactions common to esters. Overall, cyclobutanecarboxylic acid, 1-(hydroxymethyl)-, ethyl ester is a versatile compound with potential applications in various chemical fields.
Formula:C8H14O3
InChI:InChI=1S/C8H14O3/c1-2-11-7(10)8(6-9)4-3-5-8/h9H,2-6H2,1H3
InChI key:InChIKey=PWMQFMMZBJUHID-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1(CO)CCC1
Synonyms:- Ethyl 1-(hydroxymethyl)cyclobutanecarboxylate
- Cyclobutanecarboxylic acid, 1-(hydroxymethyl)-, ethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ethyl 1-(hydroxymethyl)cyclobutanecarboxylate, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C8H14O3Purity:97%Molecular weight:158.19Cyclobutanecarboxylic acid, 1-(hydroxymethyl)-, ethyl ester
CAS:Formula:C8H14O3Purity:97%Color and Shape:LiquidMolecular weight:158.1950Cyclobutanecarboxylic acid, 1-(hydroxymethyl)-, ethyl ester
CAS:Cyclobutanecarboxylic acid, 1-(hydroxymethyl)-, ethyl esterPurity:97%Molecular weight:158.2g/molEthyl 1-hydroxymethylcyclobutanecarboxylate
CAS:Versatile small molecule scaffoldFormula:C8H14O3Purity:Min. 95%Molecular weight:158.19 g/mol




