CAS 1195-91-1

2-Bromo-5,5-dimethyl-1,3-cyclohexanedione

Description:

2-Bromo-5,5-dimethyl-1,3-cyclohexanedione is an organic compound characterized by its unique structure, which includes a bromine atom and two methyl groups attached to a cyclohexanedione framework. This compound features a diketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the bromine atom enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. The dimethyl groups provide steric hindrance, influencing the compound's reactivity and stability. Typically, compounds like this are of interest in the fields of medicinal chemistry and materials science due to their potential biological activity and utility in synthesizing more complex molecules. Additionally, the compound's physical properties, such as solubility and melting point, are influenced by its molecular structure and functional groups. Safety precautions should be observed when handling this compound, as it may pose health risks typical of halogenated organic substances.

Formula: C₈H₁₁BrO₂

InChI: InChI=1S/C8H11BrO2/c1-8(2)3-5(10)7(9)6(11)4-8/h7H,3-4H2,1-2H3

InChI key: InChIKey=OCXANUSFMRALNG-UHFFFAOYSA-N

SMILES: CC1(C)CC(=O)C(Br)C(=O)C1

Synonyms:

• 1,3-Cyclohexanedione, 2-Bromo-5,5-Dimethyl-
• 1-Bromo-4,4-dimethyl-2,6-cyclohexanedione
• 2-Bromo-5,5-dimethyl-1,3-cyclohexanedione
• 2-Bromodimedone
• Bromodimedone

2-Bromo-5,5-dimethyl-1,3-cyclohexanedione

CAS: 1195-91-1

Formula: C₈H₁₁BrO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 219.0757

Ref: IN-DA000IW9

2-Bromo-5,5-dimethyl-cyclohexane-1,3-dione

CAS: 1195-91-1

2-Bromo-5,5-dimethyl-cyclohexane-1,3-dione

Purity: 99%

Molecular weight: 219.08g/mol

Ref: 54-OR94655

2-Bromo-5,5-dimethylcyclohexane-1,3-dione

CAS: 1195-91-1

Formula: C₈H₁₁BrO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 219.078

Ref: 10-F217601

2-Bromo-5,5-dimethyl-1,3-cyclohexanedione

CAS: 1195-91-1

2-Bromo-5,5-dimethyl-1,3-cyclohexanedione is a molecule that belongs to the class of triethyl orthoformate. It has been shown to have depressant activity in animals by inhibition of amines and deactivation of the brain monoamine oxidase system. The chemical structure of 2-bromo-5,5-dimethyl cyclohexanedione consists of a hydroxy group on the second carbon atom from the left, a chlorine atom on the third carbon atom from the left, and an isomer with a chlorine atom on the fourth carbon atom from the left. The molecular weight of this compound is 180.2 g/mol. It can be synthesized by reacting bromine with dimethoxyacetaldehyde in presence of sodium hydroxide and hydrochloric acid or by dehydrating ethyl formate with hydrogen chloride gas. This chemical can also be used as a precursor for other compounds such as

Formula: C₈H₁₁BrO₂

Purity: Min. 95%

Molecular weight: 219.08 g/mol

Ref: 3D-BAA19591