CymitQuimica logo

CAS 1195-94-4

:

Piperidinium, 2-carboxy-1,1-dimethyl-, inner salt

Description:
Piperidinium, 2-carboxy-1,1-dimethyl-, inner salt, commonly referred to as a piperidinium derivative, is an organic compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a carboxylic acid group and two methyl groups attached to the nitrogen atom, contributing to its unique properties. As an inner salt, it exhibits both acidic and basic characteristics, allowing it to participate in various chemical reactions. The presence of the carboxyl group enhances its solubility in polar solvents, making it useful in various applications, including pharmaceuticals and organic synthesis. Additionally, the piperidinium structure can influence its biological activity, potentially serving as a scaffold for drug development. Its stability and reactivity are influenced by the steric and electronic effects of the substituents on the piperidine ring. Overall, this compound is of interest in both academic research and industrial applications due to its versatile chemical behavior and potential utility in medicinal chemistry.
Formula:C8H15NO2
InChI:InChI=1S/C8H15NO2/c1-9(2)6-4-3-5-7(9)8(10)11/h7H,3-6H2,1-2H3
InChI key:InChIKey=XULZWQRXYTVUTE-UHFFFAOYSA-N
SMILES:C([O-])(=O)C1[N+](C)(C)CCCC1
Synonyms:
  • 2-Carboxy-1,1-dimethylpiperidinium hydroxide, inner salt
  • Piperidinium, 2-carboxy-1,1-dimethyl-, hydroxide, inner salt
  • 2-Piperidinecarboxylic acid, 1-methyl-, methylbetaine
  • Piperidinium, 2-carboxy-1,1-dimethyl-, inner salt
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.