CAS 119508-55-3
:4-TERT-BUTYL-2-(2,5-DIFLUOROPHENYL)-MORPHOLINE
Description:
4-Tert-butyl-2-(2,5-difluorophenyl)morpholine is a chemical compound characterized by its morpholine structure, which is a six-membered ring containing both nitrogen and oxygen atoms. The presence of a tert-butyl group enhances its hydrophobic properties, while the difluorophenyl substituent introduces electronegative fluorine atoms, which can influence the compound's reactivity and polarity. This compound is typically used in pharmaceutical research and development due to its potential biological activity. Its molecular structure suggests that it may exhibit interesting interactions with biological targets, making it a candidate for further investigation in medicinal chemistry. The presence of fluorine atoms can also enhance metabolic stability and lipophilicity, which are desirable traits in drug design. Additionally, the morpholine ring can participate in various chemical reactions, making this compound versatile in synthetic applications. Overall, 4-tert-butyl-2-(2,5-difluorophenyl)morpholine is notable for its unique structural features that may contribute to its functional properties in various chemical and biological contexts.
Formula:C14H19F2NO
InChI:InChI=1/C14H19F2NO/c1-14(2,3)17-6-7-18-13(9-17)11-8-10(15)4-5-12(11)16/h4-5,8,13H,6-7,9H2,1-3H3
SMILES:CC(C)(C)N1CCOC(C1)c1cc(ccc1F)F
Synonyms:- 4-tert-Butyl-2-(2,5-difluorophenyl)-morpholine
- Morpholine, 2-(2,5-difluorophenyl)-4-(1,1-dimethylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Morpholine, 2-(2,5-difluorophenyl)-4-(1,1-dimethylethyl)-
CAS:Formula:C14H19F2NOMolecular weight:255.3036
