CAS 119509-24-9
:Atpenin A 5
Description:
Atpenin A5 is a natural product classified as a secondary metabolite, specifically a type of alkaloid. It is derived from the fungus Aspergillus oryzae and is known for its unique chemical structure, which includes a complex bicyclic framework. This compound exhibits notable biological activity, particularly as an inhibitor of certain enzymes, making it of interest in pharmacological research. Atpenin A5 has been studied for its potential applications in treating various diseases, including its role in modulating cellular processes. The substance is characterized by its specific molecular formula and stereochemistry, which contribute to its biological effects. Additionally, it is typically analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its identity and purity. As with many natural products, Atpenin A5's properties may vary depending on the source and extraction methods used, highlighting the importance of standardized procedures in its study and application.
Formula:C15H21Cl2NO5
InChI:InChI=1S/C15H21Cl2NO5/c1-7(9(17)6-16)5-8(2)11(19)10-12(20)13(22-3)15(23-4)18-14(10)21/h7-9H,5-6H2,1-4H3,(H2,18,20,21)/t7-,8-,9-/m0/s1
InChI key:InChIKey=OVULNOOPECCZRG-CIUDSAMLSA-N
SMILES:C([C@H](C[C@@H]([C@H](CCl)Cl)C)C)(=O)C1=C(O)C(OC)=C(OC)NC1=O
Synonyms:- 2(1H)-Pyridinone, 3-(5,6-dichloro-2,4-dimethyl-1-oxohexyl)-4-hydroxy-5,6-dimethoxy-, [2S-(2R*,4R*,5S*)]-
- 2(1H)-Pyridinone, 3-[(2S,4S,5R)-5,6-dichloro-2,4-dimethyl-1-oxohexyl]-4-hydroxy-5,6-dimethoxy-
- 3-[(2S,4S,5R)-5,6-Dichloro-2,4-dimethyl-1-oxohexyl]-4-hydroxy-5,6-dimethoxy-2(1H)-pyridinone
- 3-[(2S,4S,5R)-5,6-dichloro-2,4-dimethylhexanoyl]-2-hydroxy-5,6-dimethoxypyridin-4(1H)-one
- Antibiotic FO 125A<sub>5</sub>
- Atpenin A 5
- FO 125A<sub>5</sub>
- FO 125A5
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2(1H)-Pyridinone, 3-[(2S,4S,5R)-5,6-dichloro-2,4-dimethyl-1-oxohexyl]-4-hydroxy-5,6-dimethoxy-
CAS:Formula:C15H21Cl2NO5Purity:95%Color and Shape:SolidMolecular weight:366.2369Atpenin A5
CAS:Formula:C15H21Cl2NO5Purity:≥ 95.0%Color and Shape:White to off-white powderMolecular weight:366.2Atpenin A5
CAS:Atpenin A5 is a potent and highly specific complex II inhibitor (IC50 ~10 nM).Formula:C15H21Cl2NO5Purity:97.33% - 99.91%Color and Shape:SolidMolecular weight:366.24Atpenin A5
CAS:Controlled ProductFormula:C15H21Cl2NO5Color and Shape:Off-WhiteMolecular weight:366.24Atpenin A5
CAS:Atpenin A5 is a type of polymerase chain that is reactive and can bind to the mitochondrial membrane potential. It has been shown to induce an increase in the mitochondrial membrane potential, leading to an increase in ATP production. Atpenin A5 has also been shown to have biological activity against human pathogens such as myocardial infarct and cancer cell lines. It has been shown to be effective against tumour cells, with no cytotoxic effects on normal cells. The mechanism of action may be due to its ability to induce apoptosis or inhibit cellular proliferation by binding with tissue antigens. This polymerase chain is also able to target pluripotent cells and monoclonal antibody-based primary cells, which could make it useful for research purposes. There have not been any studies conducted for the effect of Atpenin A5 on cardiac tissue.Formula:C15H21Cl2NO5Purity:Min. 95%Color and Shape:PowderMolecular weight:366.24 g/mol2(1H)-Pyridinone, 3-[(2S,4S,5R)-5,6-dichloro-2,4-dimethyl-1-oxohexyl]-4-hydroxy-5,6-dimethoxy-
CAS:Purity:≥95%Molecular weight:366.2399902






