CAS 119514-24-8

4-(thiazol-2-yl)phenol

Description:

4-(Thiazol-2-yl)phenol, with the CAS number 119514-24-8, is an organic compound characterized by the presence of a phenolic group and a thiazole ring. This compound typically exhibits a molecular structure that includes a thiazole moiety substituted at the para position of a phenolic ring. It is known for its potential biological activities, which may include antimicrobial and antifungal properties, making it of interest in pharmaceutical and agricultural applications. The thiazole ring contributes to its reactivity and interaction with biological systems. Additionally, 4-(thiazol-2-yl)phenol may exhibit solubility in organic solvents, while its phenolic nature can impart acidity, allowing it to participate in various chemical reactions, such as esterification or complexation with metal ions. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this compound represents a significant class of heterocyclic compounds with diverse applications in medicinal chemistry and materials science.

Formula: C₁₀H₆F₃NS

InChI: InChI=1/C10H6F3NS/c11-10(12,13)8-3-1-7(2-4-8)9-14-5-6-15-9/h1-6H

SMILES: c1cc(ccc1c1nccs1)C(F)(F)F

Synonyms:

• 2-[4-(Trifluoromethyl)phenyl]-1,3-thiazole
• Thiazole, 2-[4-(Trifluoromethyl)Phenyl]-

Thiazole, 2-[4-(trifluoromethyl)phenyl]-

CAS: 119514-24-8

Formula: C₁₀H₆F₃NS

Molecular weight: 229.2215

Ref: IN-DA000IX5