CymitQuimica logo

CAS 119516-86-8

:

1-(4-CYANOPHENYL)-2,5-DIMETHYLPYRROLE

Description:
1-(4-Cyanophenyl)-2,5-dimethylpyrrole is an organic compound characterized by its pyrrole ring, which is a five-membered aromatic heterocycle containing nitrogen. The presence of a cyanophenyl group at the 1-position and two methyl groups at the 2 and 5 positions of the pyrrole ring contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents due to its aromatic nature and polar functional groups. It may participate in various chemical reactions, including electrophilic substitutions and nucleophilic additions, owing to the electron-rich nature of the pyrrole ring. The cyanophenyl substituent can also enhance the compound's reactivity and potential applications in materials science, particularly in the synthesis of organic semiconductors or dyes. Additionally, the compound's structure suggests potential biological activity, making it of interest in medicinal chemistry. However, specific safety and handling guidelines should be followed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C13H12N2
InChI:InChI=1/C13H12N2/c1-10-3-4-11(2)15(10)13-7-5-12(9-14)6-8-13/h3-8H,1-2H3
InChI key:FNDFKQYZEDOHRC-UHFFFAOYSA-N
SMILES:Cc1ccc(C)n1c1ccc(cc1)C#N
Synonyms:
  • 2,5-Dimethyl-1-(4-Cyanophenyl)Pyrrole
  • 4-(2,5-dimethyl-1H-pyrrol-1-yl)benzonitrile
Found 4 products.