CAS 1195251-15-0

(5-Chloro-2-pyridinyl)-1-piperidinylmethanone

Description:

(5-Chloro-2-pyridinyl)-1-piperidinylmethanone, identified by its CAS number 1195251-15-0, is a chemical compound that features a pyridine ring substituted with a chlorine atom and a piperidine moiety. This compound typically exhibits characteristics common to both heterocyclic and aromatic compounds, including potential biological activity due to its structural components. The presence of the chloro group can influence its reactivity and solubility, while the piperidine ring may contribute to its pharmacological properties. Such compounds are often investigated for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The molecular structure suggests that it may engage in hydrogen bonding and other intermolecular interactions, which can affect its behavior in biological systems. Overall, this compound's unique combination of functional groups makes it a subject of interest in both synthetic and medicinal chemistry research.

Formula: C₁₁H₁₃ClN₂O

InChI: InChI=1S/C11H13ClN2O/c12-9-4-5-10(13-8-9)11(15)14-6-2-1-3-7-14/h4-5,8H,1-3,6-7H2

InChI key: InChIKey=SQGOSNHYUSQVSL-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(Cl)C=N1)N2CCCCC2

Synonyms:

• Methanone, (5-chloro-2-pyridinyl)-1-piperidinyl-
• (5-Chloro-2-pyridinyl)-1-piperidinylmethanone
• 5-Chloro-2-[(piperidin-1-yl)carbonyl]pyridine