CAS 119544-94-4
:4-[4-(4-chlorophenyl)-4-cyclopropyl-butyl]-1-fluoro-2-phenoxy-benzene
Description:
4-[4-(4-chlorophenyl)-4-cyclopropyl-butyl]-1-fluoro-2-phenoxy-benzene, with CAS number 119544-94-4, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple aromatic rings and functional groups. This compound features a fluorine atom and a phenoxy group, contributing to its potential biological activity and chemical reactivity. The presence of a cyclopropyl group and a chlorophenyl moiety suggests that it may exhibit unique steric and electronic properties, which can influence its interactions in biological systems. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals or agrochemicals, where they may act as intermediates or active ingredients. The specific characteristics, such as solubility, stability, and reactivity, would depend on the overall molecular configuration and the presence of substituents. Safety and handling considerations are essential, as with any chemical substance, particularly those with halogenated groups, which may pose environmental and health risks.
Formula:C25H24ClFO
InChI:InChI=1/C25H24ClFO/c26-21-14-12-20(13-15-21)23(19-10-11-19)8-4-5-18-9-16-24(27)25(17-18)28-22-6-2-1-3-7-22/h1-3,6-7,9,12-17,19,23H,4-5,8,10-11H2
SMILES:c1ccc(cc1)Oc1cc(CCCC(C2CC2)c2ccc(cc2)Cl)ccc1F
Synonyms:- Protrifenbute [ISO:BSI]
- 4-(4-(4-Chlorophenyl)-4-Cyclopropylbutyl)-1-Fluoro-2-Phenoxybenzene
- Fmc-111869
- Protrifenbute
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.