CAS 119555-47-4
:1-(2,3-dideoxy-2-fluoropentofuranosyl)cytosine
Description:
1-(2,3-Dideoxy-2-fluoropentofuranosyl)cytosine, identified by its CAS number 119555-47-4, is a nucleoside analog that features a modified sugar moiety, specifically a pentofuranosyl structure with two deoxy modifications and a fluorine substitution. This compound is characterized by its potential use in antiviral and anticancer therapies due to its ability to interfere with nucleic acid synthesis. The presence of the fluorine atom enhances its stability and bioactivity compared to natural nucleosides. The cytosine base allows for base pairing in nucleic acid structures, making it a candidate for incorporation into RNA or DNA. Its unique structural features contribute to its pharmacological properties, including the ability to inhibit viral replication or tumor growth. Additionally, the compound's solubility, stability under physiological conditions, and interaction with nucleic acid polymerases are critical factors influencing its therapeutic efficacy. Overall, 1-(2,3-dideoxy-2-fluoropentofuranosyl)cytosine represents a significant area of research in medicinal chemistry and drug development.
Formula:C9H12FN3O3
InChI:InChI=1/C9H12FN3O3/c10-6-3-5(4-14)16-8(6)13-2-1-7(11)12-9(13)15/h1-2,5-6,8,14H,3-4H2,(H2,11,12,15)
SMILES:c1cn(C2C(CC(CO)O2)F)c(nc1=N)O
Synonyms:- 1-(2,3-Dideoxy-2-fluoro-beta-D-threo-pentofuranosyl)cytosine
- 2'-F-dd-Ara-C
- 2'-Fluoro-2',3'-dideoxyarabinosylcytosine
- 2,3-Ddfpc
- 4-Amino-1-(2,3-dideoxy-2-fluoro-beta-D-threo-pentafuranosyl)-2(1H)-pyrimidinone
- 2(1H)-Pyrimidinone, 4-amino-1-(2,3-dideoxy-2-fluoro-beta-D-threo-pentafuranosyl)-
- 4-amino-1-(2,3-dideoxy-2-fluoro-beta-D-threo-pentofuranosyl)pyrimidin-2(1H)-one
- 4-amino-1-(2,3-dideoxy-2-fluoropentofuranosyl)pyrimidin-2(1H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-(2,3-Dideoxy-2-fluoropentofuranosyl)cytosine
CAS:1-(2,3-Dideoxy-2-fluoropentofuranosyl)cytosine is a cytosine analog that is structurally similar to the antiviral drug tenofovir. It has been shown to be active against human serum and logarithmic growth phase cells, as well as cancer cell lines. 1-(2,3-Dideoxy-2-fluoropentofuranosyl)cytosine inhibits HIV infection in vitro by binding to the viral reverse transcriptase enzyme, blocking its activity and preventing DNA synthesis. This drug also inhibits the replication of human immunodeficiency virus type 1 (HIV-1) and other retroviruses in cell culture.Formula:C9H12FN3O3Purity:Min. 95%Molecular weight:229.21 g/molDDG-39
CAS:DDG-39 (1-(2,3-dideoxy-2-fluoropentofuranosyl)cytosine) possesses antiviral activity with potent and selective anti-HIV-1 and HBV activity in cell culture.Formula:C9H12FN3O3Purity:99.17% - >99.99%Color and Shape:SolidMolecular weight:229.21Ref: TM-T67797
1mg180.00€5mg447.00€10mg655.00€25mg1,026.00€50mg1,388.00€100mg1,863.00€1mL*10mM (DMSO)401.00€


