
CAS 1195637-48-9
:4-(4-Aminobutyl)-2-methoxyphenol
Description:
4-(4-Aminobutyl)-2-methoxyphenol, identified by its CAS number 1195637-48-9, is an organic compound characterized by its phenolic structure, which includes a methoxy group and an aminoalkyl side chain. This compound typically exhibits properties associated with both phenols and amines, such as potential antioxidant activity due to the presence of the hydroxyl group. The amino group can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Its solubility is influenced by the presence of the methoxy group, which can enhance its hydrophobic character. Additionally, the compound may exhibit biological activity, potentially serving as a precursor in pharmaceuticals or agrochemicals. The presence of both functional groups suggests that it could engage in hydrogen bonding, affecting its physical properties like melting and boiling points. Overall, 4-(4-Aminobutyl)-2-methoxyphenol is a compound of interest in both synthetic chemistry and potential applications in medicinal chemistry.
Formula:C11H17NO2
InChI:InChI=1S/C11H17NO2/c1-14-11-8-9(4-2-3-7-12)5-6-10(11)13/h5-6,8,13H,2-4,7,12H2,1H3
InChI key:InChIKey=SYQVNZSNKKLELA-UHFFFAOYSA-N
SMILES:C(CCCN)C1=CC(OC)=C(O)C=C1
Synonyms:- 4-(4-Aminobutyl)-2-methoxyphenol
- Phenol, 4-(4-aminobutyl)-2-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.