CAS 1195650-21-5

Quinoline, 3-chloro-, hydrochloride (1:1)

Description:

Quinoline, 3-chloro-, hydrochloride (1:1) is a chemical compound characterized by its quinoline backbone, which is a bicyclic aromatic compound containing a nitrogen atom in the heterocyclic ring. The presence of a chlorine atom at the 3-position of the quinoline structure contributes to its reactivity and potential applications in various chemical reactions. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents, making it useful in biological and chemical applications. This compound may exhibit biological activity, including antimicrobial or antitumor properties, due to the structural features of quinoline derivatives. Its molecular interactions can be influenced by the presence of the chlorine substituent, which can affect the compound's electronic properties and reactivity. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₉H₆ClN·ClH

InChI: InChI=1S/C9H6ClN.ClH/c10-8-5-7-3-1-2-4-9(7)11-6-8;/h1-6H;1H

InChI key: InChIKey=KMKQOESIAXHSET-UHFFFAOYSA-N

SMILES: ClC1=CC2=C(N=C1)C=CC=C2.Cl

Synonyms:

• 3-Chloro-quinoline hydrochloride
• Quinoline, 3-chloro-, hydrochloride (1:1)