CymitQuimica logo

CAS 1195687-62-7

:

1H-Isoindole-1,3(2H)-dione, 2-[2-(1H-pyrazol-4-yl)ethyl]-

Description:
1H-Isoindole-1,3(2H)-dione, 2-[2-(1H-pyrazol-4-yl)ethyl]- is a chemical compound characterized by its isoindole core structure, which features a fused bicyclic system consisting of a five-membered and a six-membered ring. The presence of the 1H-pyrazol-4-yl group indicates that it contains a five-membered ring with two adjacent nitrogen atoms, contributing to its potential biological activity. This compound is likely to exhibit properties such as moderate solubility in organic solvents and may participate in various chemical reactions due to the presence of functional groups. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as isoindole derivatives are known for their diverse biological activities. The specific interactions and reactivity of this compound would depend on its substituents and the overall electronic environment, making it a subject of interest for further research in drug design and synthesis.
Formula:C13H11N3O2
InChI:InChI=1S/C13H11N3O2/c17-12-10-3-1-2-4-11(10)13(18)16(12)6-5-9-7-14-15-8-9/h1-4,7-8H,5-6H2,(H,14,15)
InChI key:InChIKey=FLPXNNZKIUNNPQ-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)N1CCC=3C=NNC3)=CC=CC2
Synonyms:
  • 2-(2-(1H-Pyrazol-4-yl)ethyl)isoindoline-1,3-dione
  • 1H-Isoindole-1,3(2H)-dione, 2-[2-(1H-pyrazol-4-yl)ethyl]-
  • 2-[2-(1H-Pyrazol-4-yl)ethyl]isoindole-1,3-dione
  • 2-[2-(1H-Pyrazol-4-yl)ethyl]-1H-isoindole-1,3(2H)-dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.