CAS 119580-83-5

4-Acetyl-1-methyl-1H-pyrrole-2-carbonitrile

Description:

4-Acetyl-1-methyl-1H-pyrrole-2-carbonitrile is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features an acetyl group and a cyano group, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the acetyl group suggests that it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions. The cyano group, known for its electron-withdrawing properties, can enhance the compound's reactivity in electrophilic aromatic substitution reactions. Additionally, the methyl group attached to the nitrogen atom of the pyrrole ring can influence the compound's electronic properties and steric hindrance. Overall, 4-Acetyl-1-methyl-1H-pyrrole-2-carbonitrile is of interest in the field of organic chemistry for its potential use in synthesizing more complex molecules and its role in various chemical reactions. Its specific physical and chemical properties, such as solubility and melting point, would need to be determined through experimental methods.

Formula: C₈H₈N₂O

InChI: InChI=1S/C8H8N2O/c1-6(11)7-3-8(4-9)10(2)5-7/h3,5H,1-2H3

InChI key: InChIKey=ZSJVTOHDDXTIEC-UHFFFAOYSA-N

SMILES: C(C)(=O)C=1C=C(C#N)N(C)C1

Synonyms:

• 4-Acetyl-1-methyl-1H-pyrrole-2-carbonitrile
• 1H-Pyrrole-2-carbonitrile, 4-acetyl-1-methyl-