
CAS 119580-85-7
:Methyl 4-ethenyl-1-methyl-1H-pyrrole-2-carboxylate
Description:
Methyl 4-ethenyl-1-methyl-1H-pyrrole-2-carboxylate, identified by its CAS number 119580-85-7, is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features a methyl ester functional group, contributing to its reactivity and solubility in organic solvents. The presence of the ethenyl group indicates that it can participate in various addition reactions, making it useful in synthetic organic chemistry. Its molecular structure suggests potential applications in the synthesis of more complex molecules, particularly in the fields of pharmaceuticals and agrochemicals. The compound is likely to exhibit moderate to low toxicity, typical of many pyrrole derivatives, but specific safety data should be consulted for handling and usage. Overall, Methyl 4-ethenyl-1-methyl-1H-pyrrole-2-carboxylate is a versatile building block in organic synthesis, with properties that make it suitable for further chemical transformations.
Formula:C9H11NO2
InChI:InChI=1S/C9H11NO2/c1-4-7-5-8(9(11)12-3)10(2)6-7/h4-6H,1H2,2-3H3
InChI key:InChIKey=SOMZYAUOXLOPIH-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1N(C)C=C(C=C)C1
Synonyms:- Methyl 4-ethenyl-1-methyl-1H-pyrrole-2-carboxylate
- 1H-Pyrrole-2-carboxylic acid, 4-ethenyl-1-methyl-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.