CAS 119584-70-2

2,4-Diamino-5-fluoroquinazoline

Description:

2,4-Diamino-5-fluoroquinazoline is a synthetic organic compound characterized by its quinazoline core structure, which features two amino groups at the 2 and 4 positions and a fluorine atom at the 5 position. This compound is typically a solid at room temperature and is known for its potential biological activity, particularly in the field of medicinal chemistry. The presence of amino groups suggests that it may participate in hydrogen bonding, influencing its solubility and reactivity. The fluorine atom can enhance the lipophilicity and metabolic stability of the molecule, making it an interesting candidate for drug development. Its unique structure may also confer specific pharmacological properties, potentially making it useful in targeting certain biological pathways. As with many quinazoline derivatives, it may exhibit antitumor or antimicrobial activities, although specific biological effects would depend on further empirical studies. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₈H₇FN₄

InChI: InChI=1/C8H7FN4/c9-4-2-1-3-5-6(4)7(10)13-8(11)12-5/h1-3H,(H4,10,11,12,13)

SMILES: c1cc(c2c(c1)[nH]c(=N)[nH]c2=N)F

Synonyms:

• 5-Fluoroquinazoline-2,4-diamine

2,4-Quinazolinediamine, 5-fluoro-

CAS: 119584-70-2

Formula: C₈H₇FN₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 178.1664

Ref: IN-DA000IZT

2,4-Diamino-5-fluoroquinazoline

CAS: 119584-70-2

2,4-Diamino-5-fluoroquinazoline

Purity: 98%

Color and Shape: Solid

Molecular weight: 178.17g/mol

Ref: 54-PC4099

5-Fluoro-2,4-diaminoquinazoline

CAS: 119584-70-2

Formula: C₈H₇FN₄

Purity: 97%

Molecular weight: 178.17

Ref: 10-F319058