CymitQuimica logo

CAS 119584-78-0

:

7-Fluoro-2,4-quinazolinediamine

Description:
7-Fluoro-2,4-quinazolinediamine, identified by its CAS number 119584-78-0, is a chemical compound that belongs to the quinazoline family, which is characterized by a bicyclic structure containing a benzene ring fused to a pyrimidine ring. This compound features a fluorine atom at the 7-position and two amino groups at the 2 and 4 positions of the quinazoline ring, contributing to its potential biological activity. The presence of the fluorine atom can enhance lipophilicity and influence the compound's interaction with biological targets. 7-Fluoro-2,4-quinazolinediamine may exhibit properties such as being a potential pharmacophore in medicinal chemistry, particularly in the development of pharmaceuticals targeting various diseases. Its structural characteristics suggest it could participate in hydrogen bonding and other interactions due to the amino groups, making it a candidate for further research in drug design and development. However, specific applications and biological activities would require empirical studies to elucidate its efficacy and safety profiles.
Formula:C8H7FN4
InChI:InChI=1S/C8H7FN4/c9-4-1-2-5-6(3-4)12-8(11)13-7(5)10/h1-3H,(H4,10,11,12,13)
InChI key:InChIKey=CGOMDINHOSZLAP-UHFFFAOYSA-N
SMILES:NC=1C2=C(N=C(N)N1)C=C(F)C=C2
Synonyms:
  • 2,4-Diamino-7-fluoroquinazoline
  • 2,4-Quinazolinediamine, 7-fluoro-
  • 7-Fluoro-2,4-quinazolinediamine
Found 2 products.