CAS 119584-80-4
:5-(Methylthio)-2,4-quinazolinediamine
Description:
5-(Methylthio)-2,4-quinazolinediamine, with the CAS number 119584-80-4, is a chemical compound characterized by its quinazoline core structure, which is a bicyclic compound containing both benzene and pyrimidine rings. This compound features a methylthio group (-S-CH3) at the 5-position and two amino groups (-NH2) at the 2 and 4 positions of the quinazoline ring. The presence of these functional groups contributes to its potential biological activity, making it of interest in medicinal chemistry and pharmaceutical research. The methylthio group can influence the compound's solubility, reactivity, and interaction with biological targets. Additionally, quinazoline derivatives are known for their diverse pharmacological properties, including anticancer and antimicrobial activities. The compound's molecular structure and functional groups suggest it may participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding, which are relevant in drug design and development. Overall, 5-(Methylthio)-2,4-quinazolinediamine represents a significant structure for further exploration in chemical and biological applications.
Formula:C9H10N4S
InChI:InChI=1S/C9H10N4S/c1-14-6-4-2-3-5-7(6)8(10)13-9(11)12-5/h2-4H,1H3,(H4,10,11,12,13)
InChI key:InChIKey=YCMSYAILAVGTLT-UHFFFAOYSA-N
SMILES:S(C)C=1C2=C(N=C(N)N=C2N)C=CC1
Synonyms:- 5-(Methylthio)-2,4-quinazolinediamine
- 2,4-Quinazolinediamine, 5-(methylthio)-
- 2,4-Diamino-5-(methylthio)quinazoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
