CAS 1195901-45-1

[1,1′-Biphenyl]-4-methanamine, 3′,5′-bis(trifluoromethyl)-, hydrochloride (1:1)

Description:

[1,1′-Biphenyl]-4-methanamine, 3′,5′-bis(trifluoromethyl)-, hydrochloride (1:1) is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methanamine group indicates that it contains an amine functional group, which can participate in hydrogen bonding and influence its solubility and reactivity. The trifluoromethyl groups at the 3′ and 5′ positions significantly enhance the compound's lipophilicity and may affect its electronic properties, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for certain applications. The compound's unique combination of functional groups suggests potential biological activity, although specific biological properties would require further investigation. Safety data and handling precautions should be observed, as with any chemical substance, particularly those containing amine and halogenated groups.

Formula: C₁₅H₁₁F₆N·ClH

InChI: InChI=1S/C15H11F6N.ClH/c16-14(17,18)12-5-11(6-13(7-12)15(19,20)21)10-3-1-9(8-22)2-4-10;/h1-7H,8,22H2;1H

InChI key: InChIKey=WOSAKBFCHJFZOG-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C(C=C(C(F)(F)F)C1)C2=CC=C(CN)C=C2.Cl

Synonyms:

• [1,1′-Biphenyl]-4-methanamine, 3′,5′-bis(trifluoromethyl)-, hydrochloride (1:1)

4-[3,5-BIS(TRIFLUOROMETHYL)PHENYL]BENZYLAMINE HCL

CAS: 1195901-45-1

Formula: C₁₅H₁₂ClF₆N

Purity: 95.0%

Molecular weight: 355.71

Ref: 10-F306164