CAS 1195901-61-1

Pyridine, 4-(3-pyrrolidinyl)-, hydrochloride (1:2)

Description:

Pyridine, 4-(3-pyrrolidinyl)-, hydrochloride (1:2) is a chemical compound characterized by its pyridine and pyrrolidine moieties, which contribute to its unique properties. As a hydrochloride salt, it is typically a white to off-white crystalline solid that is soluble in water and polar organic solvents. The presence of the pyrrolidine ring enhances its basicity and potential for forming hydrogen bonds, making it a versatile compound in organic synthesis and medicinal chemistry. This substance may exhibit biological activity, particularly in the context of pharmacology, where it could interact with various biological targets. Its molecular structure allows for potential applications in drug development, particularly in the design of compounds with central nervous system activity. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper laboratory practices. Overall, this compound represents an interesting intersection of heterocyclic chemistry and pharmacological potential.

Formula: C₉H₁₂N₂·2ClH

InChI: InChI=1S/C9H12N2.2ClH/c1-4-10-5-2-8(1)9-3-6-11-7-9;;/h1-2,4-5,9,11H,3,6-7H2;2*1H

InChI key: InChIKey=DMARGJHHEMQRAG-UHFFFAOYSA-N

SMILES: C1(CCNC1)C=2C=CN=CC2.Cl

Synonyms:

• Pyridine, 4-(3-pyrrolidinyl)-, hydrochloride (1:2)

4-(Pyrrolidin-3-yl)pyridine dihydrochloride

CAS: 1195901-61-1

Versatile small molecule scaffold

Formula: C₉H₁₄Cl₂N₂

Purity: Min. 95%

Molecular weight: 221.12 g/mol

Ref: 3D-VXB90161