CymitQuimica logo

CAS 1195901-63-3

:

2-Pyridinemethanamine, N-(2-furanylmethyl)-, hydrochloride (1:2)

Description:
2-Pyridinemethanamine, N-(2-furanylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its unique structure, which includes a pyridine ring and a furan moiety. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The presence of both the pyridine and furan groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as these functional groups are often associated with biological activity. The compound may exhibit properties such as being a potential ligand or a precursor in organic synthesis. Its hydrochloride form indicates that it can act as a protonated amine, which may influence its reactivity and interaction with other chemical species. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, this compound represents a class of organic molecules with diverse applications in chemical research and development.
Formula:C11H12N2O·2ClH
InChI:InChI=1S/C11H12N2O.2ClH/c1-2-6-13-10(4-1)8-12-9-11-5-3-7-14-11;;/h1-7,12H,8-9H2;2*1H
InChI key:InChIKey=IJRSJNDWGCMREM-UHFFFAOYSA-N
SMILES:C(NCC1=CC=CC=N1)C2=CC=CO2.Cl
Synonyms:
  • 2-Pyridinemethanamine, N-(2-furanylmethyl)-, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.