CymitQuimica logo

CAS 1196-13-0

:

1,3,5-Trichloro-2-nitrosobenzene

Description:
1,3,5-Trichloro-2-nitrosobenzene is an organic compound characterized by its aromatic structure, featuring a benzene ring substituted with three chlorine atoms and a nitroso group. The presence of the nitroso group (-NO) and multiple chlorine substituents contributes to its chemical reactivity and potential applications in various fields, including organic synthesis and as a reagent in chemical reactions. This compound is typically a solid at room temperature and may exhibit a yellow to brown coloration. Its chlorinated nature suggests that it may have significant environmental and health implications, as chlorinated compounds can be persistent in the environment and potentially toxic. Additionally, the nitroso group can participate in various chemical transformations, making this compound of interest in synthetic organic chemistry. Safety precautions are essential when handling this substance due to its potential hazards, including toxicity and environmental impact. Proper storage and disposal methods should be followed to mitigate risks associated with its use.
Formula:C6H2Cl3NO
InChI:InChI=1S/C6H2Cl3NO/c7-3-1-4(8)6(10-11)5(9)2-3/h1-2H
InChI key:InChIKey=ASVJEKOYAPBKKG-UHFFFAOYSA-N
SMILES:N(=O)C1=C(Cl)C=C(Cl)C=C1Cl
Synonyms:
  • 2,4,6-Trichloronitrosobenzene
  • Benzene, 1,3,5-trichloro-2-nitroso-
  • 1,3,5-Trichloro-2-nitrosobenzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.