
CAS 1196-22-1
:2-(Acetyloxy)-3-methyl-2-cyclopenten-1-one
Description:
2-(Acetyloxy)-3-methyl-2-cyclopenten-1-one, also known by its CAS number 1196-22-1, is an organic compound characterized by its unique cyclopentenone structure. This compound features a cyclopentene ring with a methyl group and an acetyloxy substituent, contributing to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid with a pleasant odor, indicative of its potential use in flavor and fragrance industries. The presence of the acetyloxy group enhances its reactivity, making it a useful intermediate in various chemical reactions, including esterification and acylation processes. Additionally, the compound may exhibit biological activity, which has drawn interest in medicinal chemistry. Its solubility in organic solvents and moderate stability under standard conditions make it a versatile compound for research and industrial applications. However, like many organic compounds, it should be handled with care, considering potential hazards associated with its chemical properties.
Formula:C8H10O3
InChI:InChI=1S/C8H10O3/c1-5-3-4-7(10)8(5)11-6(2)9/h3-4H2,1-2H3
InChI key:InChIKey=NNYIMCWMHNKLNZ-UHFFFAOYSA-N
SMILES:O(C(C)=O)C1=C(C)CCC1=O
Synonyms:- 2-Cyclopenten-1-one, 2-hydroxy-3-methyl-, acetate
- 2-(Acetyloxy)-3-methyl-2-cyclopenten-1-one
- NSC 109960
- Cyclotene acetate
- 2-Cyclopenten-1-one, 2-(acetyloxy)-3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
