CAS 1196-28-7
:2-aminopropiophenone
Description:
2-Aminopropiophenone, with the CAS number 1196-28-7, is an organic compound that belongs to the class of ketones and amines. It features a propanone structure with an amino group (-NH2) attached to the aromatic ring. This compound is typically characterized by its white to off-white crystalline appearance and has a relatively low melting point. It is soluble in organic solvents such as ethanol and acetone but has limited solubility in water due to its hydrophobic aromatic structure. 2-Aminopropiophenone is known for its role in organic synthesis and can serve as an intermediate in the production of various pharmaceuticals and dyes. Additionally, it exhibits properties that make it useful in photoinitiators for polymerization processes. As with many organic compounds, safety precautions should be taken when handling 2-aminopropiophenone, as it may pose health risks if inhaled or ingested. Proper storage and disposal methods are essential to mitigate any potential hazards associated with this chemical.
Formula:C9H11NO
InChI:InChI=1/C9H11NO/c1-2-9(11)7-5-3-4-6-8(7)10/h3-6H,2,10H2,1H3
SMILES:CCC(=O)c1ccccc1N
Synonyms:- 1-(2-Aminophenyl)propan-1-one
- 1-Propanone, 1-(2-aminophenyl)-
- Aminopropiophenone
- 2-aminopropiophenone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-(2-Amino-phenyl)-propan-1-one
CAS:Formula:C9H11NOPurity:95.0%Color and Shape:SolidMolecular weight:149.1931-(2-Aminophenyl)propan-1-one
CAS:1-(2-Aminophenyl)propan-1-one (1AP) is a cytotoxic agent that belongs to the class of iminoquinones. It is a synthetic compound that can be dimerized with copper(II) ions. 1AP has been shown to induce cell death in vitro by forming an imine with DNA, which results in the formation of reactive oxygen species and nitro groups. This drug also has nitro groups that are capable of binding to proteins and carbohydrates, which may contribute to its cytotoxic activity.
Formula:C9H11NOPurity:Min. 95%Molecular weight:149.19 g/mol



