CAS 1196-43-6
:xanthine monosodium salt
Description:
Xanthine monosodium salt, with the CAS number 1196-43-6, is a sodium salt derivative of xanthine, a purine base that is a product of the metabolism of nucleic acids. This compound typically appears as a white to off-white crystalline powder and is soluble in water, which facilitates its use in various biochemical applications. Xanthine monosodium salt is known for its role in the purine metabolism pathway and is often utilized in research related to enzymatic reactions, particularly those involving xanthine oxidase. It can also serve as a substrate in studies of purine metabolism and has potential applications in pharmacology, particularly in the development of drugs targeting conditions like gout or other disorders related to purine metabolism. The compound is generally stable under standard conditions but should be stored in a cool, dry place to maintain its integrity. As with many chemical substances, proper handling and safety precautions are essential to mitigate any potential risks associated with its use.
Formula:C5H4N4NaO2
InChI:InChI=1/C5H4N4O2.Na/c10-4-2-3(7-1-6-2)8-5(11)9-4;/h1H,(H3,6,7,8,9,10,11);
SMILES:c1nc2c([nH]1)nc(nc2O)O.[Na]
Synonyms:- sodium 6-oxo-6,7-dihydro-3H-purin-2-olate
- 1H-purine-2,6-dione, 3,7-dihydro-, monosodium salt
- Xanthine Monosodium Salt Monohydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1H-Purine-2,6-dione, 3,9-dihydro-, sodium salt (1:1)
CAS:Formula:C5H3N4NaO2Purity:%Color and Shape:SolidMolecular weight:174.0927Xanthine sodium salt
CAS:Formula:C5H3N4NaO2Purity:≥ 95.0%Color and Shape:White or off-white powderMolecular weight:174.09Xanthine sodium salt monohydrate
CAS:Xanthine sodium salt monohydrate is a dietary supplement that is used to treat metabolic disorders such as hyperuricemia and gout. It also has antiviral effects against herpes simplex virus-1 (HSV-1) and type-2 (HSV-2). Xanthine sodium salt monohydrate inhibits the production of viral DNA polymerase, which causes cell death by inhibiting the synthesis of proteins vital for cell division. Xanthine sodium salt monohydrate can be used to inhibit the growth of cancer cells in vitro. The mechanism of action is not yet fully understood, but it is thought that xanthine may inhibit phosphodiesterase activity or have a direct effect on the cell membrane.Formula:C5H3N4NaO2•H2OPurity:Min. 95 Area-%Color and Shape:PowderMolecular weight:192.11 g/molXanthine monosodium salt, monohydrate
CAS:Formula:C5H3N4NaO2Purity:98+%Color and Shape:Liquid, No data available.Molecular weight:174.095Xanthine Sodium Salt
CAS:Controlled ProductFormula:C5H3N4NaO2Color and Shape:NeatMolecular weight:174.093





