CAS 1196-92-5
:Vanillylamine
Description:
Vanillylamine, with the CAS number 1196-92-5, is an organic compound that belongs to the class of amines. It is characterized by the presence of a vanillin-derived structure, which includes a phenolic group and an amine functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. Vanillylamine is known for its aromatic properties, contributing to its potential applications in flavoring and fragrance industries. Additionally, it exhibits biological activity, which has led to interest in its use in pharmaceuticals and as a potential therapeutic agent. The compound is soluble in water and organic solvents, making it versatile for various chemical reactions. Its reactivity is influenced by the amine group, allowing it to participate in nucleophilic substitution and condensation reactions. Safety considerations should be taken into account, as with many amines, due to potential irritant properties. Overall, vanillylamine is a compound of interest in both industrial and research settings due to its unique chemical structure and properties.
Formula:C8H11NO2
InChI:InChI=1S/C8H11NO2/c1-11-8-4-6(5-9)2-3-7(8)10/h2-4,10H,5,9H2,1H3
InChI key:InChIKey=WRPWWVNUCXQDQV-UHFFFAOYSA-N
SMILES:O(C)C1=CC(CN)=CC=C1O
Synonyms:- (3-Methoxy-4-hydroxyphenyl)methylamine
- (4-Hydroxy-3-methoxyphenyl)methanamine
- 3-Methoxy-4-hydroxybenzylamine
- 4-(Aminomethyl)-2-Methoxyphenol
- 4-(Aminomethyl)-2-Methoxyphenol Hydrochloride (1:1)
- 4-Aminomethyl-2-methoxy-phenol
- 4-Hydroxy-3-methoxybenzylamine
- Capsivirol-T
- Creosol, α-amino-
- Phenol, 4-(aminomethyl)-2-methoxy-
- Vanillylamine
- [(4-Hydroxy-3-methoxyphenyl)methyl]amine
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Phenol, 4-(aminomethyl)-2-methoxy-
CAS:Formula:C8H11NO2Purity:97%Color and Shape:SolidMolecular weight:153.1784Vanillylamine
CAS:Vanillylamine, a natural product and intermediate in capsaicin biosynthesis, activates the JNK pathway, alleviates chemotherapy-induced bone marrow suppression.Formula:C8H11NO2Purity:99.56%Color and Shape:SolidMolecular weight:153.184-(Aminomethyl)-2-methoxyphenol
CAS:4-(Aminomethyl)-2-methoxyphenolFormula:C8H11NO2Purity:97%Color and Shape: off white to faint beige solidMolecular weight:153.18g/mol4-Hydroxy-3-methoxybenzylamine
CAS:4-Hydroxy-3-methoxybenzylamine is a nonsteroidal anti-inflammatory drug (NSAID) that has been shown to inhibit the production of cytokines and prostaglandins. It is metabolized by cytochrome P450 enzymes in the liver to form an amide and anhydrous sodium methyl myristate, which are excreted in urine. The reaction solution was analyzed using kinetic energy spectroscopy, which showed that 4-hydroxy-3-methoxybenzylamine reacts with vanillylamine to create a polymerase chain reaction product. This compound also has specific binding affinity for toll-like receptor 2 with high affinity, suggesting that it may have immunomodulatory properties.
Formula:C8H11NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:153.18 g/mol4-Hydroxy-3-methoxybenzylamine
CAS:Applications 4-Hydroxy-3-methoxybenzylamine (CAS# 1196-92-5) is a useful research chemical compound.
Formula:C8H11NO2Color and Shape:Beige To Light BrownMolecular weight:153.18





